C52H50 — CID 59575113
1,3,6,8-tetrakis(2,4,6-trimethylphenyl)pyrene (PubChem CID 59575113) has the molecular formula C52H50 and a molecular weight of 674.97 g/mol. Its IUPAC name is 1,3,6,8-tetrakis(2,4,6-trimethylphenyl)pyrene.
| Compound Name | 1,3,6,8-tetrakis(2,4,6-trimethylphenyl)pyrene |
|---|---|
| PubChem CID | 59575113 |
| Molecular Formula | C52H50 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | 1,3,6,8-tetrakis(2,4,6-trimethylphenyl)pyrene |
| SMILES | Cc1cc(C)c(-c2cc(-c3c(C)cc(C)cc3C)c3ccc4c(-c5c(C)cc(C)cc5C)cc(-c5c(C)cc(C)cc5C)c5ccc2c3c54)c(C)c1 |
| InChI | InChI=1S/C52H50/c1-27-17-31(5)47(32(6)18-27)43-25-44(48-33(7)19-28(2)20-34(48)8)40-15-16-42-46(50-37(11)23-30(4)24-38(50)12)26-45(41-14-13-39(43)51(40)52(41)42)49-35(9)21-29(3)22-36(49)10/h13-26H,1-12H3 |
| InChIKey | UMFZQRKORJQNSM-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|