C68H70O4 — CID 139091331
1,3,6,8-tetrakis(4-methoxy-2,6-dimethylphenyl)pyrene;bis(1,2-xylene) (PubChem CID 139091331) has the molecular formula C68H70O4 and a molecular weight of 951.30 g/mol. Its IUPAC name is 1,3,6,8-tetrakis(4-methoxy-2,6-dimethylphenyl)pyrene;bis(1,2-xylene).
| Compound Name | 1,3,6,8-tetrakis(4-methoxy-2,6-dimethylphenyl)pyrene;bis(1,2-xylene) |
|---|---|
| PubChem CID | 139091331 |
| Molecular Formula | C68H70O4 |
| Molecular Weight | 951.30 g/mol |
| Exact Mass | 950.53 |
| IUPAC Name | 1,3,6,8-tetrakis(4-methoxy-2,6-dimethylphenyl)pyrene;bis(1,2-xylene) |
| SMILES | COc1cc(C)c(-c2cc(-c3c(C)cc(OC)cc3C)c3ccc4c(-c5c(C)cc(OC)cc5C)cc(-c5c(C)cc(OC)cc5C)c5ccc2c3c54)c(C)c1.Cc1ccccc1C.Cc1ccccc1C |
| InChI | InChI=1S/C52H50O4.2C8H10/c1-27-17-35(53-9)18-28(2)47(27)43-25-44(48-29(3)19-36(54-10)20-30(48)4)40-15-16-42-46(50-33(7)23-38(56-12)24-34(50)8)26-45(41-14-13-39(43)51(40)52(41)42)49-31(5)21-37(55-11)22-32(49)6;2*1-7-5-3-4-6-8(7)2/h13-26H,1-12H3;2*3-6H,1-2H3 |
| InChIKey | XXUCFZHWFRZKHY-UHFFFAOYSA-N |
| XLogP | 18.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.30 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|