C23H25NO2 — CID 71374375
2,6-bis(4-methoxy-2,6-dimethylphenyl)pyridine (PubChem CID 71374375) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2,6-bis(4-methoxy-2,6-dimethylphenyl)pyridine.
| Compound Name | 2,6-bis(4-methoxy-2,6-dimethylphenyl)pyridine |
|---|---|
| PubChem CID | 71374375 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2,6-bis(4-methoxy-2,6-dimethylphenyl)pyridine |
| SMILES | COc1cc(C)c(-c2cccc(-c3c(C)cc(OC)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C23H25NO2/c1-14-10-18(25-5)11-15(2)22(14)20-8-7-9-21(24-20)23-16(3)12-19(26-6)13-17(23)4/h7-13H,1-6H3 |
| InChIKey | YAPJPGSAVCQIAG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |