C17H17N5O — CID 101496786
6-(4-methoxy-2,6-dimethylphenyl)-2-pyrazin-2-ylpyrimidin-4-amine (PubChem CID 101496786) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 6-(4-methoxy-2,6-dimethylphenyl)-2-pyrazin-2-ylpyrimidin-4-amine.
| Compound Name | 6-(4-methoxy-2,6-dimethylphenyl)-2-pyrazin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 101496786 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 6-(4-methoxy-2,6-dimethylphenyl)-2-pyrazin-2-ylpyrimidin-4-amine |
| SMILES | COc1cc(C)c(-c2cc(N)nc(-c3cnccn3)n2)c(C)c1 |
| InChI | InChI=1S/C17H17N5O/c1-10-6-12(23-3)7-11(2)16(10)13-8-15(18)22-17(21-13)14-9-19-4-5-20-14/h4-9H,1-3H3,(H2,18,21,22) |
| InChIKey | LSULRDVGOTXLML-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |