C11H13N5 — CID 62191917
6-propan-2-yl-2-pyrazin-2-ylpyrimidin-4-amine (PubChem CID 62191917) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-propan-2-yl-2-pyrazin-2-ylpyrimidin-4-amine.
| Compound Name | 6-propan-2-yl-2-pyrazin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62191917 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 6-propan-2-yl-2-pyrazin-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(N)nc(-c2cnccn2)n1 |
| InChI | InChI=1S/C11H13N5/c1-7(2)8-5-10(12)16-11(15-8)9-6-13-3-4-14-9/h3-7H,1-2H3,(H2,12,15,16) |
| InChIKey | NVALIPZSKPJOLD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |