C15H24N8 — CID 71681476
4-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-6-(3-methylbutyl)pyrimidine-2,4-diamine (PubChem CID 71681476) has the molecular formula C15H24N8 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-6-(3-methylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-6-(3-methylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71681476 |
| Molecular Formula | C15H24N8 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 4-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-6-(3-methylbutyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)CCc1cc(NCCNc2ccnc(N)n2)nc(N)n1 |
| InChI | InChI=1S/C15H24N8/c1-10(2)3-4-11-9-13(23-15(17)21-11)19-8-7-18-12-5-6-20-14(16)22-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H3,16,18,20,22)(H3,17,19,21,23) |
| InChIKey | CZQVBLWNQGJAEL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|