C17H21NO — CID 146163191
N-(2,6-dimethylphenyl)-4-methoxy-2,6-dimethylaniline (PubChem CID 146163191) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-methoxy-2,6-dimethylaniline.
| Compound Name | N-(2,6-dimethylphenyl)-4-methoxy-2,6-dimethylaniline |
|---|---|
| PubChem CID | 146163191 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-methoxy-2,6-dimethylaniline |
| SMILES | COc1cc(C)c(Nc2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C17H21NO/c1-11-7-6-8-12(2)16(11)18-17-13(3)9-15(19-5)10-14(17)4/h6-10,18H,1-5H3 |
| InChIKey | NUGNITGQPDJTOO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |