C9H12ClNO — CID 23348982
2-chloro-4-methoxy-N,6-dimethylaniline (PubChem CID 23348982) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is 2-chloro-4-methoxy-N,6-dimethylaniline.
| Compound Name | 2-chloro-4-methoxy-N,6-dimethylaniline |
|---|---|
| PubChem CID | 23348982 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-chloro-4-methoxy-N,6-dimethylaniline |
| SMILES | CNc1c(C)cc(OC)cc1Cl |
| InChI | InChI=1S/C9H12ClNO/c1-6-4-7(12-3)5-8(10)9(6)11-2/h4-5,11H,1-3H3 |
| InChIKey | ODNIYEACOMQPRI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|