C11H17NO — CID 23348858
N-ethyl-4-methoxy-2,6-dimethylaniline (PubChem CID 23348858) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-ethyl-4-methoxy-2,6-dimethylaniline.
| Compound Name | N-ethyl-4-methoxy-2,6-dimethylaniline |
|---|---|
| PubChem CID | 23348858 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-ethyl-4-methoxy-2,6-dimethylaniline |
| SMILES | CCNc1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C11H17NO/c1-5-12-11-8(2)6-10(13-4)7-9(11)3/h6-7,12H,5H2,1-4H3 |
| InChIKey | LFARTVLILQIBNC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|