C11H17Cl3CoN — CID 175492327
N-ethyl-2,4,6-trimethylaniline;trichlorocobalt (PubChem CID 175492327) has the molecular formula C11H17Cl3CoN and a molecular weight of 328.56 g/mol. Its IUPAC name is N-ethyl-2,4,6-trimethylaniline;trichlorocobalt.
| Compound Name | N-ethyl-2,4,6-trimethylaniline;trichlorocobalt |
|---|---|
| PubChem CID | 175492327 |
| Molecular Formula | C11H17Cl3CoN |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-ethyl-2,4,6-trimethylaniline;trichlorocobalt |
| SMILES | CCNc1c(C)cc(C)cc1C.Cl[Co](Cl)Cl |
| InChI | InChI=1S/C11H17N.3ClH.Co/c1-5-12-11-9(3)6-8(2)7-10(11)4;;;;/h6-7,12H,5H2,1-4H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | QEHPTGUYPPVFHB-UHFFFAOYSA-K |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |