C15H25N — CID 63448276
N-(3,3-dimethylbutyl)-2,4,6-trimethylaniline (PubChem CID 63448276) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2,4,6-trimethylaniline.
| Compound Name | N-(3,3-dimethylbutyl)-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 63448276 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NCCC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H25N/c1-11-9-12(2)14(13(3)10-11)16-8-7-15(4,5)6/h9-10,16H,7-8H2,1-6H3 |
| InChIKey | FSRSJSFZAAYXIP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |