C14H22BrNO — CID 103033502
2-bromo-N-(3-methoxy-3-methylbutyl)-4,6-dimethylaniline (PubChem CID 103033502) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-bromo-N-(3-methoxy-3-methylbutyl)-4,6-dimethylaniline.
| Compound Name | 2-bromo-N-(3-methoxy-3-methylbutyl)-4,6-dimethylaniline |
|---|---|
| PubChem CID | 103033502 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-bromo-N-(3-methoxy-3-methylbutyl)-4,6-dimethylaniline |
| SMILES | COC(C)(C)CCNc1c(C)cc(C)cc1Br |
| InChI | InChI=1S/C14H22BrNO/c1-10-8-11(2)13(12(15)9-10)16-7-6-14(3,4)17-5/h8-9,16H,6-7H2,1-5H3 |
| InChIKey | ZAXSAQPOADILSA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |