C12H17Br2N — CID 63421879
2,6-dibromo-N-(2,2-dimethylpropyl)-4-methylaniline (PubChem CID 63421879) has the molecular formula C12H17Br2N and a molecular weight of 335.08 g/mol. Its IUPAC name is 2,6-dibromo-N-(2,2-dimethylpropyl)-4-methylaniline.
| Compound Name | 2,6-dibromo-N-(2,2-dimethylpropyl)-4-methylaniline |
|---|---|
| PubChem CID | 63421879 |
| Molecular Formula | C12H17Br2N |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2,6-dibromo-N-(2,2-dimethylpropyl)-4-methylaniline |
| SMILES | Cc1cc(Br)c(NCC(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2N/c1-8-5-9(13)11(10(14)6-8)15-7-12(2,3)4/h5-6,15H,7H2,1-4H3 |
| InChIKey | MQLKBIXDLAOSRT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |