C9H9Br2F2N — CID 60922012
2,6-dibromo-N-(2,2-difluoroethyl)-4-methylaniline (PubChem CID 60922012) has the molecular formula C9H9Br2F2N and a molecular weight of 328.98 g/mol. Its IUPAC name is 2,6-dibromo-N-(2,2-difluoroethyl)-4-methylaniline.
| Compound Name | 2,6-dibromo-N-(2,2-difluoroethyl)-4-methylaniline |
|---|---|
| PubChem CID | 60922012 |
| Molecular Formula | C9H9Br2F2N |
| Molecular Weight | 328.98 g/mol |
| Exact Mass | 326.91 |
| IUPAC Name | 2,6-dibromo-N-(2,2-difluoroethyl)-4-methylaniline |
| SMILES | Cc1cc(Br)c(NCC(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H9Br2F2N/c1-5-2-6(10)9(7(11)3-5)14-4-8(12)13/h2-3,8,14H,4H2,1H3 |
| InChIKey | QDVTVKSUSBNTNN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |