C9H10BrF2N — CID 107583058
3-bromo-N-(2,2-difluoroethyl)-5-methylaniline (PubChem CID 107583058) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is 3-bromo-N-(2,2-difluoroethyl)-5-methylaniline.
| Compound Name | 3-bromo-N-(2,2-difluoroethyl)-5-methylaniline |
|---|---|
| PubChem CID | 107583058 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 3-bromo-N-(2,2-difluoroethyl)-5-methylaniline |
| SMILES | Cc1cc(Br)cc(NCC(F)F)c1 |
| InChI | InChI=1S/C9H10BrF2N/c1-6-2-7(10)4-8(3-6)13-5-9(11)12/h2-4,9,13H,5H2,1H3 |
| InChIKey | CPJRVLZIIUMWKL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |