C14H12BrF2N — CID 107582170
3-bromo-N-[(2,6-difluorophenyl)methyl]-5-methylaniline (PubChem CID 107582170) has the molecular formula C14H12BrF2N and a molecular weight of 312.16 g/mol. Its IUPAC name is 3-bromo-N-[(2,6-difluorophenyl)methyl]-5-methylaniline.
| Compound Name | 3-bromo-N-[(2,6-difluorophenyl)methyl]-5-methylaniline |
|---|---|
| PubChem CID | 107582170 |
| Molecular Formula | C14H12BrF2N |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-bromo-N-[(2,6-difluorophenyl)methyl]-5-methylaniline |
| SMILES | Cc1cc(Br)cc(NCc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C14H12BrF2N/c1-9-5-10(15)7-11(6-9)18-8-12-13(16)3-2-4-14(12)17/h2-7,18H,8H2,1H3 |
| InChIKey | DCOVRUBAGPCNKX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |