C14H12F3N — CID 55118977
N-[(2,6-difluorophenyl)methyl]-4-fluoro-3-methylaniline (PubChem CID 55118977) has the molecular formula C14H12F3N and a molecular weight of 251.25 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-4-fluoro-3-methylaniline.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-4-fluoro-3-methylaniline |
|---|---|
| PubChem CID | 55118977 |
| Molecular Formula | C14H12F3N |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-4-fluoro-3-methylaniline |
| SMILES | Cc1cc(NCc2c(F)cccc2F)ccc1F |
| InChI | InChI=1S/C14H12F3N/c1-9-7-10(5-6-12(9)15)18-8-11-13(16)3-2-4-14(11)17/h2-7,18H,8H2,1H3 |
| InChIKey | XMNLSZCHLFEEPD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |