C14H11F4N — CID 63050571
4-fluoro-3-methyl-N-[(3,4,5-trifluorophenyl)methyl]aniline (PubChem CID 63050571) has the molecular formula C14H11F4N and a molecular weight of 269.24 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[(3,4,5-trifluorophenyl)methyl]aniline.
| Compound Name | 4-fluoro-3-methyl-N-[(3,4,5-trifluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 63050571 |
| Molecular Formula | C14H11F4N |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-fluoro-3-methyl-N-[(3,4,5-trifluorophenyl)methyl]aniline |
| SMILES | Cc1cc(NCc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C14H11F4N/c1-8-4-10(2-3-11(8)15)19-7-9-5-12(16)14(18)13(17)6-9/h2-6,19H,7H2,1H3 |
| InChIKey | YBTUDGGCGTXTOA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|