C11H12Br3NO2 — CID 103236803
methyl 2-bromo-3-(2,6-dibromo-4-methylanilino)propanoate (PubChem CID 103236803) has the molecular formula C11H12Br3NO2 and a molecular weight of 429.93 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,6-dibromo-4-methylanilino)propanoate.
| Compound Name | methyl 2-bromo-3-(2,6-dibromo-4-methylanilino)propanoate |
|---|---|
| PubChem CID | 103236803 |
| Molecular Formula | C11H12Br3NO2 |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 426.84 |
| IUPAC Name | methyl 2-bromo-3-(2,6-dibromo-4-methylanilino)propanoate |
| SMILES | COC(=O)C(Br)CNc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C11H12Br3NO2/c1-6-3-7(12)10(8(13)4-6)15-5-9(14)11(16)17-2/h3-4,9,15H,5H2,1-2H3 |
| InChIKey | PXARVBYOQCNSKN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|