C9H9Br2NO2 — CID 116654064
methyl N-(2,6-dibromo-4-methylphenyl)carbamate (PubChem CID 116654064) has the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. Its IUPAC name is methyl N-(2,6-dibromo-4-methylphenyl)carbamate.
| Compound Name | methyl N-(2,6-dibromo-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 116654064 |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 g/mol |
| Exact Mass | 320.90 |
| IUPAC Name | methyl N-(2,6-dibromo-4-methylphenyl)carbamate |
| SMILES | COC(=O)Nc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C9H9Br2NO2/c1-5-3-6(10)8(7(11)4-5)12-9(13)14-2/h3-4H,1-2H3,(H,12,13) |
| InChIKey | SJLOASWIDCFAGR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |