C13H18Br2N2O — CID 76892746
2-amino-N-(2,6-dibromo-4-methylphenyl)-3,3-dimethylbutanamide (PubChem CID 76892746) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 2-amino-N-(2,6-dibromo-4-methylphenyl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(2,6-dibromo-4-methylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 76892746 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2-amino-N-(2,6-dibromo-4-methylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(Br)c(NC(=O)C(N)C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C13H18Br2N2O/c1-7-5-8(14)10(9(15)6-7)17-12(18)11(16)13(2,3)4/h5-6,11H,16H2,1-4H3,(H,17,18) |
| InChIKey | MDFJKCKSNDTXEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |