C13H18Br2N2O — CID 28991563
(2R)-2-amino-N-(2,6-dibromo-4-methylphenyl)-4-methylpentanamide (PubChem CID 28991563) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,6-dibromo-4-methylphenyl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(2,6-dibromo-4-methylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 28991563 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | (2R)-2-amino-N-(2,6-dibromo-4-methylphenyl)-4-methylpentanamide |
| SMILES | Cc1cc(Br)c(NC(=O)[C@H](N)CC(C)C)c(Br)c1 |
| InChI | InChI=1S/C13H18Br2N2O/c1-7(2)4-11(16)13(18)17-12-9(14)5-8(3)6-10(12)15/h5-7,11H,4,16H2,1-3H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | LZKIIFAGLVGWLE-LLVKDONJSA-N |
| XLogP | 3.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |