C12H15BrClFN2O — CID 107611929
(2R)-2-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-4-methylpentanamide (PubChem CID 107611929) has the molecular formula C12H15BrClFN2O and a molecular weight of 337.62 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 107611929 |
| Molecular Formula | C12H15BrClFN2O |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (2R)-2-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C12H15BrClFN2O/c1-6(2)3-10(16)12(18)17-11-8(13)4-7(15)5-9(11)14/h4-6,10H,3,16H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | GWBHFNGNQOYLIL-SNVBAGLBSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |