C12H15Cl2FN2O — CID 83079399
2-amino-N-(2,6-dichloro-4-fluorophenyl)-4-methylpentanamide (PubChem CID 83079399) has the molecular formula C12H15Cl2FN2O and a molecular weight of 293.17 g/mol. Its IUPAC name is 2-amino-N-(2,6-dichloro-4-fluorophenyl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(2,6-dichloro-4-fluorophenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 83079399 |
| Molecular Formula | C12H15Cl2FN2O |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-amino-N-(2,6-dichloro-4-fluorophenyl)-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O/c1-6(2)3-10(16)12(18)17-11-8(13)4-7(15)5-9(11)14/h4-6,10H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | OIWWGBOZNPBZHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |