C10H11ClF2N2O — CID 83087285
(2S)-2-amino-N-(2-chloro-4,6-difluorophenyl)butanamide (PubChem CID 83087285) has the molecular formula C10H11ClF2N2O and a molecular weight of 248.66 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-chloro-4,6-difluorophenyl)butanamide.
| Compound Name | (2S)-2-amino-N-(2-chloro-4,6-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 83087285 |
| Molecular Formula | C10H11ClF2N2O |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (2S)-2-amino-N-(2-chloro-4,6-difluorophenyl)butanamide |
| SMILES | CC[C@H](N)C(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H11ClF2N2O/c1-2-8(14)10(16)15-9-6(11)3-5(12)4-7(9)13/h3-4,8H,2,14H2,1H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | RRQHFKOOHCOKBE-QMMMGPOBSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |