C11H12Cl2N2O3 — CID 82831163
4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid (PubChem CID 82831163) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid.
| Compound Name | 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 82831163 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid |
| SMILES | CCC(N)C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c1-2-8(14)10(16)15-9-6(12)3-5(11(17)18)4-7(9)13/h3-4,8H,2,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ULUXRDMTANQIHB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |