4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid

C11H12Cl2N2O3 — CID 82831163

IUPAC4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid
SMILESCCC(N)C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl
InChIInChI=1S/C11H12Cl2N2O3/c1-2-8(14)10(16)15-9-6(12)3-5(11(17)18)4-7(9)13/h3-4,8H,2,14H2,1H3,(H,15,16)(H,17,18)
InChIKeyULUXRDMTANQIHB-UHFFFAOYSA-N
MW291.13 g/mol
LogP2.37
Rot. Bonds4

About 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid

4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid (PubChem CID 82831163) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid.

Molecular Properties

Compound Name4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid
PubChem CID82831163
Molecular FormulaC11H12Cl2N2O3
Molecular Weight291.13 g/mol
Exact Mass290.02
IUPAC Name4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid
SMILESCCC(N)C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl
InChIInChI=1S/C11H12Cl2N2O3/c1-2-8(14)10(16)15-9-6(12)3-5(11(17)18)4-7(9)13/h3-4,8H,2,14H2,1H3,(H,15,16)(H,17,18)
InChIKeyULUXRDMTANQIHB-UHFFFAOYSA-N
XLogP2.37
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.13
LogP ≤ 52.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid?
The IUPAC name of 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid (CID 82831163) is 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid.
What is the SMILES notation for 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid?
The canonical SMILES for 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid is CCC(N)C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl.
What is the InChIKey of 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid?
The InChIKey is ULUXRDMTANQIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O3/c1-2-8(14)10(16)15-9-6(12)3-5(11(17)18)4-7(9)13/h3-4,8H,2,14H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid?
4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid has a molecular weight of 291.13 g/mol, XLogP of 2.37, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminobutanoylamino)-3,5-dichlorobenzoic acid is sourced from PubChem (CID 82831163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).