C10H10Cl2N2O3 — CID 82830134
4-[[(2R)-2-aminopropanoyl]amino]-3,5-dichlorobenzoic acid (PubChem CID 82830134) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is 4-[[(2R)-2-aminopropanoyl]amino]-3,5-dichlorobenzoic acid.
| Compound Name | 4-[[(2R)-2-aminopropanoyl]amino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 82830134 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 4-[[(2R)-2-aminopropanoyl]amino]-3,5-dichlorobenzoic acid |
| SMILES | C[C@@H](N)C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-4(13)9(15)14-8-6(11)2-5(10(16)17)3-7(8)12/h2-4H,13H2,1H3,(H,14,15)(H,16,17)/t4-/m1/s1 |
| InChIKey | GLBOPTBEDBMMEM-SCSAIBSYSA-N |
| XLogP | 1.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |