C11H13BrCl2N2O — CID 28993455
(2R)-2-amino-N-(4-bromo-2,6-dichlorophenyl)-3-methylbutanamide (PubChem CID 28993455) has the molecular formula C11H13BrCl2N2O and a molecular weight of 340.05 g/mol. Its IUPAC name is (2R)-2-amino-N-(4-bromo-2,6-dichlorophenyl)-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-(4-bromo-2,6-dichlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 28993455 |
| Molecular Formula | C11H13BrCl2N2O |
| Molecular Weight | 340.05 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | (2R)-2-amino-N-(4-bromo-2,6-dichlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](N)C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrCl2N2O/c1-5(2)9(15)11(17)16-10-7(13)3-6(12)4-8(10)14/h3-5,9H,15H2,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | BSOBCPYAXHROGO-SECBINFHSA-N |
| XLogP | 3.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.05 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |