C11H13BrCl2N2O2 — CID 62474980
2-amino-N-(4-bromo-2,6-dichlorophenyl)-4-methoxybutanamide (PubChem CID 62474980) has the molecular formula C11H13BrCl2N2O2 and a molecular weight of 356.05 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-2,6-dichlorophenyl)-4-methoxybutanamide.
| Compound Name | 2-amino-N-(4-bromo-2,6-dichlorophenyl)-4-methoxybutanamide |
|---|---|
| PubChem CID | 62474980 |
| Molecular Formula | C11H13BrCl2N2O2 |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-amino-N-(4-bromo-2,6-dichlorophenyl)-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrCl2N2O2/c1-18-3-2-9(15)11(17)16-10-7(13)4-6(12)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | SFLNCLQZICSJSF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |