C11H13Br3N2O — CID 107568149
(2S)-2-amino-N-(2,4,6-tribromophenyl)pentanamide (PubChem CID 107568149) has the molecular formula C11H13Br3N2O and a molecular weight of 428.95 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,4,6-tribromophenyl)pentanamide.
| Compound Name | (2S)-2-amino-N-(2,4,6-tribromophenyl)pentanamide |
|---|---|
| PubChem CID | 107568149 |
| Molecular Formula | C11H13Br3N2O |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 425.86 |
| IUPAC Name | (2S)-2-amino-N-(2,4,6-tribromophenyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br3N2O/c1-2-3-9(15)11(17)16-10-7(13)4-6(12)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | JDXAIHCIQTWTPB-VIFPVBQESA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |