C11H11F5N2O — CID 107570332
(2R)-2-amino-N-(2,3,4,5,6-pentafluorophenyl)pentanamide (PubChem CID 107570332) has the molecular formula C11H11F5N2O and a molecular weight of 282.21 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,3,4,5,6-pentafluorophenyl)pentanamide.
| Compound Name | (2R)-2-amino-N-(2,3,4,5,6-pentafluorophenyl)pentanamide |
|---|---|
| PubChem CID | 107570332 |
| Molecular Formula | C11H11F5N2O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R)-2-amino-N-(2,3,4,5,6-pentafluorophenyl)pentanamide |
| SMILES | CCC[C@@H](N)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2O/c1-2-3-4(17)11(19)18-10-8(15)6(13)5(12)7(14)9(10)16/h4H,2-3,17H2,1H3,(H,18,19)/t4-/m1/s1 |
| InChIKey | CKQVZOYZVYVPQB-SCSAIBSYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|