C11H13F3N2O — CID 94872912
(2S)-2-amino-N-(2,3,5-trifluorophenyl)pentanamide (PubChem CID 94872912) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,3,5-trifluorophenyl)pentanamide.
| Compound Name | (2S)-2-amino-N-(2,3,5-trifluorophenyl)pentanamide |
|---|---|
| PubChem CID | 94872912 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2S)-2-amino-N-(2,3,5-trifluorophenyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H13F3N2O/c1-2-3-8(15)11(17)16-9-5-6(12)4-7(13)10(9)14/h4-5,8H,2-3,15H2,1H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | JOIPBCLWFOCVFW-QMMMGPOBSA-N |
| XLogP | 2.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|