2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid

C12H14Cl2N2O3 — CID 107569132

IUPAC2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid
SMILESCCC[C@@H](N)C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-2-3-9(15)11(17)16-10-7(12(18)19)4-6(13)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17)(H,18,19)/t9-/m1/s1
InChIKeyMOBCCONZUFDGOL-SECBINFHSA-N
MW305.16 g/mol
LogP2.76
Rot. Bonds5

About 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid

2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid (PubChem CID 107569132) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid.

Molecular Properties

Compound Name2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid
PubChem CID107569132
Molecular FormulaC12H14Cl2N2O3
Molecular Weight305.16 g/mol
Exact Mass304.04
IUPAC Name2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid
SMILESCCC[C@@H](N)C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O
InChIInChI=1S/C12H14Cl2N2O3/c1-2-3-9(15)11(17)16-10-7(12(18)19)4-6(13)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17)(H,18,19)/t9-/m1/s1
InChIKeyMOBCCONZUFDGOL-SECBINFHSA-N
XLogP2.76
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.16
LogP ≤ 52.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid?
The IUPAC name of 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid (CID 107569132) is 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid.
What is the SMILES notation for 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid?
The canonical SMILES for 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid is CCC[C@@H](N)C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O.
What is the InChIKey of 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid?
The InChIKey is MOBCCONZUFDGOL-SECBINFHSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3/c1-2-3-9(15)11(17)16-10-7(12(18)19)4-6(13)5-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17)(H,18,19)/t9-/m1/s1.
What are the key properties of 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid?
2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid has a molecular weight of 305.16 g/mol, XLogP of 2.76, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2-aminopentanoyl]amino]-3,5-dichlorobenzoic acid is sourced from PubChem (CID 107569132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).