C11H11Cl2N3O4 — CID 43360187
2-[2-(carbamoylamino)propanoylamino]-3,5-dichlorobenzoic acid (PubChem CID 43360187) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)propanoylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 2-[2-(carbamoylamino)propanoylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 43360187 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-[2-(carbamoylamino)propanoylamino]-3,5-dichlorobenzoic acid |
| SMILES | CC(NC(N)=O)C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H11Cl2N3O4/c1-4(15-11(14)20)9(17)16-8-6(10(18)19)2-5(12)3-7(8)13/h2-4H,1H3,(H,16,17)(H,18,19)(H3,14,15,20) |
| InChIKey | IRYTUGMRIZUILN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |