C14H18Cl2N2O3 — CID 61194367
3,5-dichloro-2-[[propan-2-yl(propyl)carbamoyl]amino]benzoic acid (PubChem CID 61194367) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is 3,5-dichloro-2-[[propan-2-yl(propyl)carbamoyl]amino]benzoic acid.
| Compound Name | 3,5-dichloro-2-[[propan-2-yl(propyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61194367 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3,5-dichloro-2-[[propan-2-yl(propyl)carbamoyl]amino]benzoic acid |
| SMILES | CCCN(C(=O)Nc1c(Cl)cc(Cl)cc1C(=O)O)C(C)C |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-4-5-18(8(2)3)14(21)17-12-10(13(19)20)6-9(15)7-11(12)16/h6-8H,4-5H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | WWRBGALGEZPNOT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |