C9H7Cl3FNO — CID 83078635
2-chloro-N-(2,6-dichloro-4-fluorophenyl)propanamide (PubChem CID 83078635) has the molecular formula C9H7Cl3FNO and a molecular weight of 270.52 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dichloro-4-fluorophenyl)propanamide.
| Compound Name | 2-chloro-N-(2,6-dichloro-4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 83078635 |
| Molecular Formula | C9H7Cl3FNO |
| Molecular Weight | 270.52 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 2-chloro-N-(2,6-dichloro-4-fluorophenyl)propanamide |
| SMILES | CC(Cl)C(=O)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C9H7Cl3FNO/c1-4(10)9(15)14-8-6(11)2-5(13)3-7(8)12/h2-4H,1H3,(H,14,15) |
| InChIKey | VCBQKVFHBPRODO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|