C10H11Cl2FN2O — CID 116657360
1-(2,6-dichloro-4-fluorophenyl)-3-propan-2-ylurea (PubChem CID 116657360) has the molecular formula C10H11Cl2FN2O and a molecular weight of 265.12 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-fluorophenyl)-3-propan-2-ylurea.
| Compound Name | 1-(2,6-dichloro-4-fluorophenyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 116657360 |
| Molecular Formula | C10H11Cl2FN2O |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 1-(2,6-dichloro-4-fluorophenyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H11Cl2FN2O/c1-5(2)14-10(16)15-9-7(11)3-6(13)4-8(9)12/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | LLKNFXPKKJPOGG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |