C15H22BrClFN — CID 107610149
2-bromo-6-chloro-N-(2,6-dimethylheptan-4-yl)-4-fluoroaniline (PubChem CID 107610149) has the molecular formula C15H22BrClFN and a molecular weight of 350.70 g/mol. Its IUPAC name is 2-bromo-6-chloro-N-(2,6-dimethylheptan-4-yl)-4-fluoroaniline.
| Compound Name | 2-bromo-6-chloro-N-(2,6-dimethylheptan-4-yl)-4-fluoroaniline |
|---|---|
| PubChem CID | 107610149 |
| Molecular Formula | C15H22BrClFN |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-bromo-6-chloro-N-(2,6-dimethylheptan-4-yl)-4-fluoroaniline |
| SMILES | CC(C)CC(CC(C)C)Nc1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C15H22BrClFN/c1-9(2)5-12(6-10(3)4)19-15-13(16)7-11(18)8-14(15)17/h7-10,12,19H,5-6H2,1-4H3 |
| InChIKey | DFEYFEADAWLVBL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |