C11H13BrClFN2S — CID 107610834
1-(2-bromo-6-chloro-4-fluorophenyl)-3-(2-methylpropyl)thiourea (PubChem CID 107610834) has the molecular formula C11H13BrClFN2S and a molecular weight of 339.66 g/mol. Its IUPAC name is 1-(2-bromo-6-chloro-4-fluorophenyl)-3-(2-methylpropyl)thiourea.
| Compound Name | 1-(2-bromo-6-chloro-4-fluorophenyl)-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 107610834 |
| Molecular Formula | C11H13BrClFN2S |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 1-(2-bromo-6-chloro-4-fluorophenyl)-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C11H13BrClFN2S/c1-6(2)5-15-11(17)16-10-8(12)3-7(14)4-9(10)13/h3-4,6H,5H2,1-2H3,(H2,15,16,17) |
| InChIKey | IUAOEHHMGXXLJT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|