C11H14BrFN2S — CID 115662463
1-(3-bromo-4-fluorophenyl)-3-(2-methylpropyl)thiourea (PubChem CID 115662463) has the molecular formula C11H14BrFN2S and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-3-(2-methylpropyl)thiourea.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 115662463 |
| Molecular Formula | C11H14BrFN2S |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H14BrFN2S/c1-7(2)6-14-11(16)15-8-3-4-10(13)9(12)5-8/h3-5,7H,6H2,1-2H3,(H2,14,15,16) |
| InChIKey | DNKHTVGNPVZPTB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|