C12H16Br2N2O2 — CID 13419970
2-amino-N-(3,5-dibromo-4-hydroxyphenyl)-4-methylpentanamide (PubChem CID 13419970) has the molecular formula C12H16Br2N2O2 and a molecular weight of 380.08 g/mol. Its IUPAC name is 2-amino-N-(3,5-dibromo-4-hydroxyphenyl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(3,5-dibromo-4-hydroxyphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 13419970 |
| Molecular Formula | C12H16Br2N2O2 |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 2-amino-N-(3,5-dibromo-4-hydroxyphenyl)-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C12H16Br2N2O2/c1-6(2)3-10(15)12(18)16-7-4-8(13)11(17)9(14)5-7/h4-6,10,17H,3,15H2,1-2H3,(H,16,18) |
| InChIKey | UQWSQRFPXSZUPR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|