C16H20ClN2O- — CID 5351894
2-amino-4-methyl-N-naphthalen-2-ylpentanamide chloride (PubChem CID 5351894) has the molecular formula C16H20ClN2O- and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-amino-4-methyl-N-naphthalen-2-ylpentanamide chloride.
| Compound Name | 2-amino-4-methyl-N-naphthalen-2-ylpentanamide chloride |
|---|---|
| PubChem CID | 5351894 |
| Molecular Formula | C16H20ClN2O- |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-amino-4-methyl-N-naphthalen-2-ylpentanamide chloride |
| SMILES | CC(C)CC(N)C(=O)Nc1ccc2ccccc2c1.[Cl-] |
| InChI | InChI=1S/C16H20N2O.ClH/c1-11(2)9-15(17)16(19)18-14-8-7-12-5-3-4-6-13(12)10-14;/h3-8,10-11,15H,9,17H2,1-2H3,(H,18,19);1H/p-1 |
| InChIKey | HTHKKWZMEVJWQF-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |