C14H18N2OS — CID 104902766
(2R)-2-amino-N-(1-benzothiophen-5-yl)-4-methylpentanamide (PubChem CID 104902766) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is (2R)-2-amino-N-(1-benzothiophen-5-yl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(1-benzothiophen-5-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 104902766 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2R)-2-amino-N-(1-benzothiophen-5-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C14H18N2OS/c1-9(2)7-12(15)14(17)16-11-3-4-13-10(8-11)5-6-18-13/h3-6,8-9,12H,7,15H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | ICVAAHGQRNFSJR-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |