C16H22N2OS — CID 107471323
2-(aminomethyl)-N-(1-benzothiophen-5-yl)-4,4-dimethylpentanamide (PubChem CID 107471323) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1-benzothiophen-5-yl)-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(1-benzothiophen-5-yl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107471323 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(aminomethyl)-N-(1-benzothiophen-5-yl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(CN)C(=O)Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C16H22N2OS/c1-16(2,3)9-12(10-17)15(19)18-13-4-5-14-11(8-13)6-7-20-14/h4-8,12H,9-10,17H2,1-3H3,(H,18,19) |
| InChIKey | IIGWEEKDJSDBSL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |