C15H17N3O2 — CID 7020027
(2S)-2-amino-N-naphthalen-2-ylpentanediamide (PubChem CID 7020027) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-2-amino-N-naphthalen-2-ylpentanediamide.
| Compound Name | (2S)-2-amino-N-naphthalen-2-ylpentanediamide |
|---|---|
| PubChem CID | 7020027 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2S)-2-amino-N-naphthalen-2-ylpentanediamide |
| SMILES | NC(=O)CC[C@H](N)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H17N3O2/c16-13(7-8-14(17)19)15(20)18-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8,16H2,(H2,17,19)(H,18,20)/t13-/m0/s1 |
| InChIKey | SCBLXQAXDOWFIH-ZDUSSCGKSA-N |
| XLogP | 1.37 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |