C17H21NO — CID 58642005
(2S)-2,4-dimethyl-N-naphthalen-2-ylpentanamide (PubChem CID 58642005) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-N-naphthalen-2-ylpentanamide.
| Compound Name | (2S)-2,4-dimethyl-N-naphthalen-2-ylpentanamide |
|---|---|
| PubChem CID | 58642005 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2S)-2,4-dimethyl-N-naphthalen-2-ylpentanamide |
| SMILES | CC(C)C[C@H](C)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21NO/c1-12(2)10-13(3)17(19)18-16-9-8-14-6-4-5-7-15(14)11-16/h4-9,11-13H,10H2,1-3H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | NBIHQTGPVOQTPV-ZDUSSCGKSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |