C19H27N — CID 43680210
N-(2,6-dimethylheptan-4-yl)naphthalen-2-amine (PubChem CID 43680210) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-yl)naphthalen-2-amine.
| Compound Name | N-(2,6-dimethylheptan-4-yl)naphthalen-2-amine |
|---|---|
| PubChem CID | 43680210 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-(2,6-dimethylheptan-4-yl)naphthalen-2-amine |
| SMILES | CC(C)CC(CC(C)C)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H27N/c1-14(2)11-19(12-15(3)4)20-18-10-9-16-7-5-6-8-17(16)13-18/h5-10,13-15,19-20H,11-12H2,1-4H3 |
| InChIKey | ITGLUIIHHOMQJH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |