C10H7Br2F4NO — CID 114033268
N-(2,6-dibromo-4-methylphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 114033268) has the molecular formula C10H7Br2F4NO and a molecular weight of 392.97 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 114033268 |
| Molecular Formula | C10H7Br2F4NO |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 390.88 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1cc(Br)c(NC(=O)C(F)(F)C(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H7Br2F4NO/c1-4-2-5(11)7(6(12)3-4)17-9(18)10(15,16)8(13)14/h2-3,8H,1H3,(H,17,18) |
| InChIKey | NGJCBLLTGFIWFN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|