C10H8ClF4NO — CID 103769557
N-(2-chloro-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103769557) has the molecular formula C10H8ClF4NO and a molecular weight of 269.63 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-chloro-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103769557 |
| Molecular Formula | C10H8ClF4NO |
| Molecular Weight | 269.63 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H8ClF4NO/c1-5-2-3-6(11)7(4-5)16-9(17)10(14,15)8(12)13/h2-4,8H,1H3,(H,16,17) |
| InChIKey | RIOSTBAKCQHYOW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|