C11H10ClF4NO — CID 113251859
N-(2-chloro-4,6-dimethylphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 113251859) has the molecular formula C11H10ClF4NO and a molecular weight of 283.65 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113251859 |
| Molecular Formula | C11H10ClF4NO |
| Molecular Weight | 283.65 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClF4NO/c1-5-3-6(2)8(7(12)4-5)17-10(18)11(15,16)9(13)14/h3-4,9H,1-2H3,(H,17,18) |
| InChIKey | SVLXDCYTKZZPFN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|